C23H21FN4S — CID 10971477
4-[5-(4-fluorophenyl)-2-methylsulfanyl-1H-imidazol-4-yl]-N-(2-phenylethyl)pyridin-2-amine (PubChem CID 10971477) has the molecular formula C23H21FN4S and a molecular weight of 404.51 g/mol. Its IUPAC name is 4-[5-(4-fluorophenyl)-2-methylsulfanyl-1H-imidazol-4-yl]-N-(2-phenylethyl)pyridin-2-amine.
| Compound Name | 4-[5-(4-fluorophenyl)-2-methylsulfanyl-1H-imidazol-4-yl]-N-(2-phenylethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 10971477 |
| Molecular Formula | C23H21FN4S |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 4-[5-(4-fluorophenyl)-2-methylsulfanyl-1H-imidazol-4-yl]-N-(2-phenylethyl)pyridin-2-amine |
| SMILES | CSc1nc(-c2ccnc(NCCc3ccccc3)c2)c(-c2ccc(F)cc2)[nH]1 |
| InChI | InChI=1S/C23H21FN4S/c1-29-23-27-21(17-7-9-19(24)10-8-17)22(28-23)18-12-14-26-20(15-18)25-13-11-16-5-3-2-4-6-16/h2-10,12,14-15H,11,13H2,1H3,(H,25,26)(H,27,28) |
| InChIKey | UETJFNLFLVHJIO-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |