C19H39NO6Si — CID 10971503
tert-butyl (2R,3R,4S)-2-[(1S)-4-[tert-butyl(dimethyl)silyl]oxy-1-hydroxybutyl]-3,4-dihydroxypyrrolidine-1-carboxylate (PubChem CID 10971503) has the molecular formula C19H39NO6Si and a molecular weight of 405.61 g/mol. Its IUPAC name is tert-butyl (2R,3R,4S)-2-[(1S)-4-[tert-butyl(dimethyl)silyl]oxy-1-hydroxybutyl]-3,4-dihydroxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R,3R,4S)-2-[(1S)-4-[tert-butyl(dimethyl)silyl]oxy-1-hydroxybutyl]-3,4-dihydroxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 10971503 |
| Molecular Formula | C19H39NO6Si |
| Molecular Weight | 405.61 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | tert-butyl (2R,3R,4S)-2-[(1S)-4-[tert-butyl(dimethyl)silyl]oxy-1-hydroxybutyl]-3,4-dihydroxypyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](O)[C@H](O)[C@H]1[C@@H](O)CCCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H39NO6Si/c1-18(2,3)26-17(24)20-12-14(22)16(23)15(20)13(21)10-9-11-25-27(7,8)19(4,5)6/h13-16,21-23H,9-12H2,1-8H3/t13-,14-,15+,16-/m0/s1 |
| InChIKey | KPOGZIVQHDBTEN-JONQDZQNSA-N |
| XLogP | 2.49 |
| TPSA | 99.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.61 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|