C25H46O2Si — CID 10971546
(2S,3R)-4-[(1S,4aS,8aS)-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-3-[tert-butyl(dimethyl)silyl]oxy-2-methylbutanal (PubChem CID 10971546) has the molecular formula C25H46O2Si and a molecular weight of 406.73 g/mol. Its IUPAC name is (2S,3R)-4-[(1S,4aS,8aS)-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-3-[tert-butyl(dimethyl)silyl]oxy-2-methylbutanal.
| Compound Name | (2S,3R)-4-[(1S,4aS,8aS)-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-3-[tert-butyl(dimethyl)silyl]oxy-2-methylbutanal |
|---|---|
| PubChem CID | 10971546 |
| Molecular Formula | C25H46O2Si |
| Molecular Weight | 406.73 g/mol |
| Exact Mass | 406.33 |
| IUPAC Name | (2S,3R)-4-[(1S,4aS,8aS)-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-3-[tert-butyl(dimethyl)silyl]oxy-2-methylbutanal |
| SMILES | CC1=CC[C@H]2C(C)(C)CCC[C@]2(C)[C@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C=O |
| InChI | InChI=1S/C25H46O2Si/c1-18-12-13-22-24(6,7)14-11-15-25(22,8)20(18)16-21(19(2)17-26)27-28(9,10)23(3,4)5/h12,17,19-22H,11,13-16H2,1-10H3/t19-,20+,21-,22+,25-/m1/s1 |
| InChIKey | OESWTYIAAPFERM-YLYPHGCXSA-N |
| XLogP | 7.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.73 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|