C20H10F3N3O4 — CID 10971685
2,2,2-trifluoro-N-[2-(2,5,10-trioxo-1H-pyrido[3,2-g]quinolin-6-yl)phenyl]acetamide (PubChem CID 10971685) has the molecular formula C20H10F3N3O4 and a molecular weight of 413.31 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[2-(2,5,10-trioxo-1H-pyrido[3,2-g]quinolin-6-yl)phenyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[2-(2,5,10-trioxo-1H-pyrido[3,2-g]quinolin-6-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 10971685 |
| Molecular Formula | C20H10F3N3O4 |
| Molecular Weight | 413.31 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | 2,2,2-trifluoro-N-[2-(2,5,10-trioxo-1H-pyrido[3,2-g]quinolin-6-yl)phenyl]acetamide |
| SMILES | O=C1c2nccc(-c3ccccc3NC(=O)C(F)(F)F)c2C(=O)c2ccc(=O)[nH]c21 |
| InChI | InChI=1S/C20H10F3N3O4/c21-20(22,23)19(30)25-12-4-2-1-3-9(12)10-7-8-24-16-14(10)17(28)11-5-6-13(27)26-15(11)18(16)29/h1-8H,(H,25,30)(H,26,27) |
| InChIKey | AOLNSOSEKLYMGN-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 108.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.31 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|