C24H23N5O2 — CID 10971692
(6R)-14-methyl-27-oxo-20-oxa-3,7,11,13-tetrazapentacyclo[19.3.1.13,6.115,19.09,13]heptacosa-1(25),9,11,15(26),16,18,21,23-octaene-18-carbonitrile (PubChem CID 10971692) has the molecular formula C24H23N5O2 and a molecular weight of 413.48 g/mol. Its IUPAC name is (6R)-14-methyl-27-oxo-20-oxa-3,7,11,13-tetrazapentacyclo[19.3.1.13,6.115,19.09,13]heptacosa-1(25),9,11,15(26),16,18,21,23-octaene-18-carbonitrile.
| Compound Name | (6R)-14-methyl-27-oxo-20-oxa-3,7,11,13-tetrazapentacyclo[19.3.1.13,6.115,19.09,13]heptacosa-1(25),9,11,15(26),16,18,21,23-octaene-18-carbonitrile |
|---|---|
| PubChem CID | 10971692 |
| Molecular Formula | C24H23N5O2 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | (6R)-14-methyl-27-oxo-20-oxa-3,7,11,13-tetrazapentacyclo[19.3.1.13,6.115,19.09,13]heptacosa-1(25),9,11,15(26),16,18,21,23-octaene-18-carbonitrile |
| SMILES | CC1c2ccc(C#N)c(c2)Oc2cccc(c2)CN2CC[C@@H](NCc3cncn31)C2=O |
| InChI | InChI=1S/C24H23N5O2/c1-16-18-5-6-19(11-25)23(10-18)31-21-4-2-3-17(9-21)14-28-8-7-22(24(28)30)27-13-20-12-26-15-29(16)20/h2-6,9-10,12,15-16,22,27H,7-8,13-14H2,1H3/t16?,22-/m1/s1 |
| InChIKey | CIFGPLIJBYKXOG-VXNXSFHZSA-N |
| XLogP | 3.36 |
| TPSA | 83.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |