C28H26N2O2 — CID 10971892
1-(1,2-diphenylethyl)-1-methyl-3-(4-phenoxyphenyl)urea (PubChem CID 10971892) has the molecular formula C28H26N2O2 and a molecular weight of 422.53 g/mol. Its IUPAC name is 1-(1,2-diphenylethyl)-1-methyl-3-(4-phenoxyphenyl)urea.
| Compound Name | 1-(1,2-diphenylethyl)-1-methyl-3-(4-phenoxyphenyl)urea |
|---|---|
| PubChem CID | 10971892 |
| Molecular Formula | C28H26N2O2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 1-(1,2-diphenylethyl)-1-methyl-3-(4-phenoxyphenyl)urea |
| SMILES | CN(C(=O)Nc1ccc(Oc2ccccc2)cc1)C(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H26N2O2/c1-30(27(23-13-7-3-8-14-23)21-22-11-5-2-6-12-22)28(31)29-24-17-19-26(20-18-24)32-25-15-9-4-10-16-25/h2-20,27H,21H2,1H3,(H,29,31) |
| InChIKey | HYZNDDWYTHIDIO-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |