C24H19F2NO4 — CID 10971914
[4-[4-[2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]phenyl]phenyl] ethyl carbonate (PubChem CID 10971914) has the molecular formula C24H19F2NO4 and a molecular weight of 423.42 g/mol. Its IUPAC name is [4-[4-[2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]phenyl]phenyl] ethyl carbonate.
| Compound Name | [4-[4-[2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]phenyl]phenyl] ethyl carbonate |
|---|---|
| PubChem CID | 10971914 |
| Molecular Formula | C24H19F2NO4 |
| Molecular Weight | 423.42 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | [4-[4-[2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]phenyl]phenyl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1ccc(-c2ccc(C3COC(c4c(F)cccc4F)=N3)cc2)cc1 |
| InChI | InChI=1S/C24H19F2NO4/c1-2-29-24(28)31-18-12-10-16(11-13-18)15-6-8-17(9-7-15)21-14-30-23(27-21)22-19(25)4-3-5-20(22)26/h3-13,21H,2,14H2,1H3 |
| InChIKey | SVPJKQGXEWKIFN-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.42 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|