C25H29NO4Si — CID 10972140
(E,3S)-7-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-3-[dimethyl(phenyl)silyl]-7-oxohept-5-enal (PubChem CID 10972140) has the molecular formula C25H29NO4Si and a molecular weight of 435.60 g/mol. Its IUPAC name is (E,3S)-7-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-3-[dimethyl(phenyl)silyl]-7-oxohept-5-enal.
| Compound Name | (E,3S)-7-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-3-[dimethyl(phenyl)silyl]-7-oxohept-5-enal |
|---|---|
| PubChem CID | 10972140 |
| Molecular Formula | C25H29NO4Si |
| Molecular Weight | 435.60 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | (E,3S)-7-[(4S)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-3-[dimethyl(phenyl)silyl]-7-oxohept-5-enal |
| SMILES | C[Si](C)(c1ccccc1)[C@H](CC=O)C/C=C/C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C25H29NO4Si/c1-31(2,22-12-7-4-8-13-22)23(16-17-27)14-9-15-24(28)26-21(19-30-25(26)29)18-20-10-5-3-6-11-20/h3-13,15,17,21,23H,14,16,18-19H2,1-2H3/b15-9+/t21-,23-/m0/s1 |
| InChIKey | GRVRVGOGGYBTDE-FBHZIKQKSA-N |
| XLogP | 4.10 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.60 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|