C24H18N4O3S — CID 10972258
N-(3-methyl-1,2-thiazol-5-yl)-2-oxo-2-[1-[(3-phenyl-1,2-oxazol-5-yl)methyl]indol-3-yl]acetamide (PubChem CID 10972258) has the molecular formula C24H18N4O3S and a molecular weight of 442.50 g/mol. Its IUPAC name is N-(3-methyl-1,2-thiazol-5-yl)-2-oxo-2-[1-[(3-phenyl-1,2-oxazol-5-yl)methyl]indol-3-yl]acetamide.
| Compound Name | N-(3-methyl-1,2-thiazol-5-yl)-2-oxo-2-[1-[(3-phenyl-1,2-oxazol-5-yl)methyl]indol-3-yl]acetamide |
|---|---|
| PubChem CID | 10972258 |
| Molecular Formula | C24H18N4O3S |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | N-(3-methyl-1,2-thiazol-5-yl)-2-oxo-2-[1-[(3-phenyl-1,2-oxazol-5-yl)methyl]indol-3-yl]acetamide |
| SMILES | Cc1cc(NC(=O)C(=O)c2cn(Cc3cc(-c4ccccc4)no3)c3ccccc23)sn1 |
| InChI | InChI=1S/C24H18N4O3S/c1-15-11-22(32-27-15)25-24(30)23(29)19-14-28(21-10-6-5-9-18(19)21)13-17-12-20(26-31-17)16-7-3-2-4-8-16/h2-12,14H,13H2,1H3,(H,25,30) |
| InChIKey | ZSIATSWILOZFJB-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 90.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|