About 1-diphenylphosphanyl-N,N-dimethylpropan-2-amine
1-diphenylphosphanyl-N,N-dimethylpropan-2-amine (PubChem CID 10972379) has the molecular formula C17H22NP
and a molecular weight of 271.34 g/mol. Its IUPAC name is 1-diphenylphosphanyl-N,N-dimethylpropan-2-amine.
Molecular Properties
| Compound Name | 1-diphenylphosphanyl-N,N-dimethylpropan-2-amine |
| PubChem CID | 10972379 |
| Molecular Formula | C17H22NP |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | 1-diphenylphosphanyl-N,N-dimethylpropan-2-amine |
| SMILES | CC(CP(c1ccccc1)c1ccccc1)N(C)C |
| InChI | InChI=1S/C17H22NP/c1-15(18(2)3)14-19(16-10-6-4-7-11-16)17-12-8-5-9-13-17/h4-13,15H,14H2,1-3H3 |
| InChIKey | UWEBDCWURVZJOK-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-diphenylphosphanyl-N,N-dimethylpropan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-diphenylphosphanyl-N,N-dimethylpropan-2-amine?
The IUPAC name of 1-diphenylphosphanyl-N,N-dimethylpropan-2-amine (CID 10972379) is 1-diphenylphosphanyl-N,N-dimethylpropan-2-amine.
What is the SMILES notation for 1-diphenylphosphanyl-N,N-dimethylpropan-2-amine?
The canonical SMILES for 1-diphenylphosphanyl-N,N-dimethylpropan-2-amine is CC(CP(c1ccccc1)c1ccccc1)N(C)C.
What is the InChIKey of 1-diphenylphosphanyl-N,N-dimethylpropan-2-amine?
The InChIKey is UWEBDCWURVZJOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22NP/c1-15(18(2)3)14-19(16-10-6-4-7-11-16)17-12-8-5-9-13-17/h4-13,15H,14H2,1-3H3.
What are the key properties of 1-diphenylphosphanyl-N,N-dimethylpropan-2-amine?
1-diphenylphosphanyl-N,N-dimethylpropan-2-amine has a molecular weight of 271.34 g/mol, XLogP of 3.07, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-diphenylphosphanyl-N,N-dimethylpropan-2-amine is sourced from PubChem (CID 10972379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).