C22H44O7Si2 — CID 10972830
(6aR,8S,9S,10R,10aR)-8-methoxy-2,2,4,4-tetra(propan-2-yl)-10-prop-2-enoxy-6,6a,8,9,10,10a-hexahydropyrano[3,2-f][1,3,5,2,4]trioxadisilocin-9-ol (PubChem CID 10972830) has the molecular formula C22H44O7Si2 and a molecular weight of 476.76 g/mol. Its IUPAC name is (6aR,8S,9S,10R,10aR)-8-methoxy-2,2,4,4-tetra(propan-2-yl)-10-prop-2-enoxy-6,6a,8,9,10,10a-hexahydropyrano[3,2-f][1,3,5,2,4]trioxadisilocin-9-ol.
| Compound Name | (6aR,8S,9S,10R,10aR)-8-methoxy-2,2,4,4-tetra(propan-2-yl)-10-prop-2-enoxy-6,6a,8,9,10,10a-hexahydropyrano[3,2-f][1,3,5,2,4]trioxadisilocin-9-ol |
|---|---|
| PubChem CID | 10972830 |
| Molecular Formula | C22H44O7Si2 |
| Molecular Weight | 476.76 g/mol |
| Exact Mass | 476.26 |
| IUPAC Name | (6aR,8S,9S,10R,10aR)-8-methoxy-2,2,4,4-tetra(propan-2-yl)-10-prop-2-enoxy-6,6a,8,9,10,10a-hexahydropyrano[3,2-f][1,3,5,2,4]trioxadisilocin-9-ol |
| SMILES | C=CCO[C@@H]1[C@H](O)[C@@H](OC)O[C@@H]2CO[Si](C(C)C)(C(C)C)O[Si](C(C)C)(C(C)C)O[C@@H]12 |
| InChI | InChI=1S/C22H44O7Si2/c1-11-12-25-21-19(23)22(24-10)27-18-13-26-30(14(2)3,15(4)5)29-31(16(6)7,17(8)9)28-20(18)21/h11,14-23H,1,12-13H2,2-10H3/t18-,19+,20-,21-,22+/m1/s1 |
| InChIKey | DXWAWUGKILBTIC-YHINDDMVSA-N |
| XLogP | 4.25 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.76 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|