About benzyl (2S,3R)-3-[1-(benzenesulfonyl)ethyl]-1-[(1S)-1-phenylethyl]pyrrolidine-2-carboxylate
benzyl (2S,3R)-3-[1-(benzenesulfonyl)ethyl]-1-[(1S)-1-phenylethyl]pyrrolidine-2-carboxylate (PubChem CID 10972839) has the molecular formula C28H31NO4S
and a molecular weight of 477.63 g/mol. Its IUPAC name is benzyl (2S,3R)-3-[1-(benzenesulfonyl)ethyl]-1-[(1S)-1-phenylethyl]pyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | benzyl (2S,3R)-3-[1-(benzenesulfonyl)ethyl]-1-[(1S)-1-phenylethyl]pyrrolidine-2-carboxylate |
| PubChem CID | 10972839 |
| Molecular Formula | C28H31NO4S |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | benzyl (2S,3R)-3-[1-(benzenesulfonyl)ethyl]-1-[(1S)-1-phenylethyl]pyrrolidine-2-carboxylate |
| SMILES | CC([C@@H]1CCN([C@@H](C)c2ccccc2)[C@@H]1C(=O)OCc1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C28H31NO4S/c1-21(24-14-8-4-9-15-24)29-19-18-26(22(2)34(31,32)25-16-10-5-11-17-25)27(29)28(30)33-20-23-12-6-3-7-13-23/h3-17,21-22,26-27H,18-20H2,1-2H3/t21-,22?,26-,27-/m0/s1 |
| InChIKey | CHPYXORUAKILNJ-TZLMYRMVSA-N |
| XLogP | 5.04 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze benzyl (2S,3R)-3-[1-(benzenesulfonyl)ethyl]-1-[(1S)-1-phenylethyl]pyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl (2S,3R)-3-[1-(benzenesulfonyl)ethyl]-1-[(1S)-1-phenylethyl]pyrrolidine-2-carboxylate?
The IUPAC name of benzyl (2S,3R)-3-[1-(benzenesulfonyl)ethyl]-1-[(1S)-1-phenylethyl]pyrrolidine-2-carboxylate (CID 10972839) is benzyl (2S,3R)-3-[1-(benzenesulfonyl)ethyl]-1-[(1S)-1-phenylethyl]pyrrolidine-2-carboxylate.
What is the SMILES notation for benzyl (2S,3R)-3-[1-(benzenesulfonyl)ethyl]-1-[(1S)-1-phenylethyl]pyrrolidine-2-carboxylate?
The canonical SMILES for benzyl (2S,3R)-3-[1-(benzenesulfonyl)ethyl]-1-[(1S)-1-phenylethyl]pyrrolidine-2-carboxylate is CC([C@@H]1CCN([C@@H](C)c2ccccc2)[C@@H]1C(=O)OCc1ccccc1)S(=O)(=O)c1ccccc1.
What is the InChIKey of benzyl (2S,3R)-3-[1-(benzenesulfonyl)ethyl]-1-[(1S)-1-phenylethyl]pyrrolidine-2-carboxylate?
The InChIKey is CHPYXORUAKILNJ-TZLMYRMVSA-N. The full InChI is InChI=1S/C28H31NO4S/c1-21(24-14-8-4-9-15-24)29-19-18-26(22(2)34(31,32)25-16-10-5-11-17-25)27(29)28(30)33-20-23-12-6-3-7-13-23/h3-17,21-22,26-27H,18-20H2,1-2H3/t21-,22?,26-,27-/m0/s1.
What are the key properties of benzyl (2S,3R)-3-[1-(benzenesulfonyl)ethyl]-1-[(1S)-1-phenylethyl]pyrrolidine-2-carboxylate?
benzyl (2S,3R)-3-[1-(benzenesulfonyl)ethyl]-1-[(1S)-1-phenylethyl]pyrrolidine-2-carboxylate has a molecular weight of 477.63 g/mol, XLogP of 5.04, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl (2S,3R)-3-[1-(benzenesulfonyl)ethyl]-1-[(1S)-1-phenylethyl]pyrrolidine-2-carboxylate is sourced from PubChem (CID 10972839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).