C30H44O3Si — CID 10972873
tert-butyl-[(2R,3E,5E)-8-(2-methoxypropan-2-yloxy)-2,6-dimethylocta-3,5-dienoxy]-diphenylsilane (PubChem CID 10972873) has the molecular formula C30H44O3Si and a molecular weight of 480.77 g/mol. Its IUPAC name is tert-butyl-[(2R,3E,5E)-8-(2-methoxypropan-2-yloxy)-2,6-dimethylocta-3,5-dienoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(2R,3E,5E)-8-(2-methoxypropan-2-yloxy)-2,6-dimethylocta-3,5-dienoxy]-diphenylsilane |
|---|---|
| PubChem CID | 10972873 |
| Molecular Formula | C30H44O3Si |
| Molecular Weight | 480.77 g/mol |
| Exact Mass | 480.31 |
| IUPAC Name | tert-butyl-[(2R,3E,5E)-8-(2-methoxypropan-2-yloxy)-2,6-dimethylocta-3,5-dienoxy]-diphenylsilane |
| SMILES | COC(C)(C)OCC/C(C)=C/C=C/[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H44O3Si/c1-25(22-23-32-30(6,7)31-8)16-15-17-26(2)24-33-34(29(3,4)5,27-18-11-9-12-19-27)28-20-13-10-14-21-28/h9-21,26H,22-24H2,1-8H3/b17-15+,25-16+/t26-/m1/s1 |
| InChIKey | YZOVKSZBOBOIKC-JDNCPWSXSA-N |
| XLogP | 6.49 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.77 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|