About 3,4-dibromo-2-(3,5-dibromo-2-methoxyphenyl)-1H-pyrrole
3,4-dibromo-2-(3,5-dibromo-2-methoxyphenyl)-1H-pyrrole (PubChem CID 10972991) has the molecular formula C11H7Br4NO
and a molecular weight of 488.80 g/mol. Its IUPAC name is 3,4-dibromo-2-(3,5-dibromo-2-methoxyphenyl)-1H-pyrrole.
Molecular Properties
| Compound Name | 3,4-dibromo-2-(3,5-dibromo-2-methoxyphenyl)-1H-pyrrole |
| PubChem CID | 10972991 |
| Molecular Formula | C11H7Br4NO |
| Molecular Weight | 488.80 g/mol |
| Exact Mass | 484.73 |
| IUPAC Name | 3,4-dibromo-2-(3,5-dibromo-2-methoxyphenyl)-1H-pyrrole |
| SMILES | COc1c(Br)cc(Br)cc1-c1[nH]cc(Br)c1Br |
| InChI | InChI=1S/C11H7Br4NO/c1-17-11-6(2-5(12)3-7(11)13)10-9(15)8(14)4-16-10/h2-4,16H,1H3 |
| InChIKey | LOCZVIMIWQWXEZ-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 488.80 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3,4-dibromo-2-(3,5-dibromo-2-methoxyphenyl)-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dibromo-2-(3,5-dibromo-2-methoxyphenyl)-1H-pyrrole?
The IUPAC name of 3,4-dibromo-2-(3,5-dibromo-2-methoxyphenyl)-1H-pyrrole (CID 10972991) is 3,4-dibromo-2-(3,5-dibromo-2-methoxyphenyl)-1H-pyrrole.
What is the SMILES notation for 3,4-dibromo-2-(3,5-dibromo-2-methoxyphenyl)-1H-pyrrole?
The canonical SMILES for 3,4-dibromo-2-(3,5-dibromo-2-methoxyphenyl)-1H-pyrrole is COc1c(Br)cc(Br)cc1-c1[nH]cc(Br)c1Br.
What is the InChIKey of 3,4-dibromo-2-(3,5-dibromo-2-methoxyphenyl)-1H-pyrrole?
The InChIKey is LOCZVIMIWQWXEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7Br4NO/c1-17-11-6(2-5(12)3-7(11)13)10-9(15)8(14)4-16-10/h2-4,16H,1H3.
What are the key properties of 3,4-dibromo-2-(3,5-dibromo-2-methoxyphenyl)-1H-pyrrole?
3,4-dibromo-2-(3,5-dibromo-2-methoxyphenyl)-1H-pyrrole has a molecular weight of 488.80 g/mol, XLogP of 5.74, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dibromo-2-(3,5-dibromo-2-methoxyphenyl)-1H-pyrrole is sourced from PubChem (CID 10972991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).