C22H26BrNO5S — CID 10973082
(3R)-1-(4-bromophenyl)-3-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane-4-carbonyl]pentane-1,4-dione (PubChem CID 10973082) has the molecular formula C22H26BrNO5S and a molecular weight of 496.42 g/mol. Its IUPAC name is (3R)-1-(4-bromophenyl)-3-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane-4-carbonyl]pentane-1,4-dione.
| Compound Name | (3R)-1-(4-bromophenyl)-3-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane-4-carbonyl]pentane-1,4-dione |
|---|---|
| PubChem CID | 10973082 |
| Molecular Formula | C22H26BrNO5S |
| Molecular Weight | 496.42 g/mol |
| Exact Mass | 495.07 |
| IUPAC Name | (3R)-1-(4-bromophenyl)-3-[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane-4-carbonyl]pentane-1,4-dione |
| SMILES | CC(=O)[C@@H](CC(=O)c1ccc(Br)cc1)C(=O)N1[C@@H]2C[C@H]3CC[C@]2(CS1(=O)=O)C3(C)C |
| InChI | InChI=1S/C22H26BrNO5S/c1-13(25)17(11-18(26)14-4-6-16(23)7-5-14)20(27)24-19-10-15-8-9-22(19,21(15,2)3)12-30(24,28)29/h4-7,15,17,19H,8-12H2,1-3H3/t15-,17-,19-,22-/m1/s1 |
| InChIKey | ALRWCKJTTZKPHW-YDVTWLGESA-N |
| XLogP | 3.59 |
| TPSA | 88.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.42 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|