C24H48OSiSn — CID 10973130
trimethyl-[(4S,5E)-2-(tributylstannylmethyl)octa-1,5,7-trien-4-yl]oxysilane (PubChem CID 10973130) has the molecular formula C24H48OSiSn and a molecular weight of 499.44 g/mol. Its IUPAC name is trimethyl-[(4S,5E)-2-(tributylstannylmethyl)octa-1,5,7-trien-4-yl]oxysilane.
| Compound Name | trimethyl-[(4S,5E)-2-(tributylstannylmethyl)octa-1,5,7-trien-4-yl]oxysilane |
|---|---|
| PubChem CID | 10973130 |
| Molecular Formula | C24H48OSiSn |
| Molecular Weight | 499.44 g/mol |
| Exact Mass | 500.25 |
| IUPAC Name | trimethyl-[(4S,5E)-2-(tributylstannylmethyl)octa-1,5,7-trien-4-yl]oxysilane |
| SMILES | C=C/C=C/[C@H](CC(=C)C[Sn](CCCC)(CCCC)CCCC)O[Si](C)(C)C |
| InChI | InChI=1S/C12H21OSi.3C4H9.Sn/c1-7-8-9-12(10-11(2)3)13-14(4,5)6;3*1-3-4-2;/h7-9,12H,1-3,10H2,4-6H3;3*1,3-4H2,2H3;/b9-8+;;;;/t12-;;;;/m1..../s1 |
| InChIKey | HIDSSZDDTFPWPI-HRWSDQABSA-N |
| XLogP | 8.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.44 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|