C25H50O6Si2 — CID 10973169
[(2R)-1-[(2S,3S,4S,5R,6R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-4-methyloxan-2-yl]but-3-en-2-yl] acetate (PubChem CID 10973169) has the molecular formula C25H50O6Si2 and a molecular weight of 502.84 g/mol. Its IUPAC name is [(2R)-1-[(2S,3S,4S,5R,6R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-4-methyloxan-2-yl]but-3-en-2-yl] acetate.
| Compound Name | [(2R)-1-[(2S,3S,4S,5R,6R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-4-methyloxan-2-yl]but-3-en-2-yl] acetate |
|---|---|
| PubChem CID | 10973169 |
| Molecular Formula | C25H50O6Si2 |
| Molecular Weight | 502.84 g/mol |
| Exact Mass | 502.31 |
| IUPAC Name | [(2R)-1-[(2S,3S,4S,5R,6R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methoxy-4-methyloxan-2-yl]but-3-en-2-yl] acetate |
| SMILES | C=C[C@@H](C[C@@H]1O[C@@H](OC)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)[C@@H]1O[Si](C)(C)C(C)(C)C)OC(C)=O |
| InChI | InChI=1S/C25H50O6Si2/c1-15-19(28-18(3)26)16-20-21(30-32(11,12)24(4,5)6)17(2)22(23(27-10)29-20)31-33(13,14)25(7,8)9/h15,17,19-23H,1,16H2,2-14H3/t17-,19-,20-,21-,22+,23+/m0/s1 |
| InChIKey | TUEHZLOFNLLYJE-CMMFHVHCSA-N |
| XLogP | 6.28 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.84 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|