C31H42O5Si — CID 10973379
(1S,3R,6R,8S,11R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-6,8-dimethyl-2,7,12-trioxatricyclo[9.4.0.03,8]pentadecan-5-one (PubChem CID 10973379) has the molecular formula C31H42O5Si and a molecular weight of 522.76 g/mol. Its IUPAC name is (1S,3R,6R,8S,11R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-6,8-dimethyl-2,7,12-trioxatricyclo[9.4.0.03,8]pentadecan-5-one.
| Compound Name | (1S,3R,6R,8S,11R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-6,8-dimethyl-2,7,12-trioxatricyclo[9.4.0.03,8]pentadecan-5-one |
|---|---|
| PubChem CID | 10973379 |
| Molecular Formula | C31H42O5Si |
| Molecular Weight | 522.76 g/mol |
| Exact Mass | 522.28 |
| IUPAC Name | (1S,3R,6R,8S,11R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-6,8-dimethyl-2,7,12-trioxatricyclo[9.4.0.03,8]pentadecan-5-one |
| SMILES | CC(C)(C)[Si](OC[C@@]1(C)O[C@@]2(C)CC[C@H]3OCCC[C@@H]3O[C@@H]2CC1=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H42O5Si/c1-29(2,3)37(23-13-8-6-9-14-23,24-15-10-7-11-16-24)34-22-31(5)27(32)21-28-30(4,36-31)19-18-25-26(35-28)17-12-20-33-25/h6-11,13-16,25-26,28H,12,17-22H2,1-5H3/t25-,26+,28-,30+,31-/m1/s1 |
| InChIKey | UWTBCRVFUIHQFY-ZLDHYGPUSA-N |
| XLogP | 4.80 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.76 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|