C32H50O6 — CID 10973455
(4S,5S)-7-(2-methoxyethoxymethoxymethyl)-2,2,6,6,8-pentamethyl-4-[(1R,2R)-2-(phenylmethoxymethyl)cyclohexyl]-1,3-dioxaspiro[4.5]dec-7-ene (PubChem CID 10973455) has the molecular formula C32H50O6 and a molecular weight of 530.75 g/mol. Its IUPAC name is (4S,5S)-7-(2-methoxyethoxymethoxymethyl)-2,2,6,6,8-pentamethyl-4-[(1R,2R)-2-(phenylmethoxymethyl)cyclohexyl]-1,3-dioxaspiro[4.5]dec-7-ene.
| Compound Name | (4S,5S)-7-(2-methoxyethoxymethoxymethyl)-2,2,6,6,8-pentamethyl-4-[(1R,2R)-2-(phenylmethoxymethyl)cyclohexyl]-1,3-dioxaspiro[4.5]dec-7-ene |
|---|---|
| PubChem CID | 10973455 |
| Molecular Formula | C32H50O6 |
| Molecular Weight | 530.75 g/mol |
| Exact Mass | 530.36 |
| IUPAC Name | (4S,5S)-7-(2-methoxyethoxymethoxymethyl)-2,2,6,6,8-pentamethyl-4-[(1R,2R)-2-(phenylmethoxymethyl)cyclohexyl]-1,3-dioxaspiro[4.5]dec-7-ene |
| SMILES | COCCOCOCC1=C(C)CC[C@]2(OC(C)(C)O[C@H]2[C@@H]2CCCC[C@H]2COCc2ccccc2)C1(C)C |
| InChI | InChI=1S/C32H50O6/c1-24-16-17-32(30(2,3)28(24)22-36-23-34-19-18-33-6)29(37-31(4,5)38-32)27-15-11-10-14-26(27)21-35-20-25-12-8-7-9-13-25/h7-9,12-13,26-27,29H,10-11,14-23H2,1-6H3/t26-,27+,29-,32+/m0/s1 |
| InChIKey | JKIGUJWEDPVDBZ-MKIMBKOTSA-N |
| XLogP | 6.67 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.75 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|