C31H42O8 — CID 10973579
[(3R)-5-oxooxolan-3-yl] (2R,3S,6S,7S,9R)-2-[(2S,5S)-5-(3-hydroxyphenyl)-5-methoxypentan-2-yl]-3,9,11,11-tetramethyl-8-oxo-1-oxaspiro[5.5]undec-4-ene-7-carboxylate (PubChem CID 10973579) has the molecular formula C31H42O8 and a molecular weight of 542.67 g/mol. Its IUPAC name is [(3R)-5-oxooxolan-3-yl] (2R,3S,6S,7S,9R)-2-[(2S,5S)-5-(3-hydroxyphenyl)-5-methoxypentan-2-yl]-3,9,11,11-tetramethyl-8-oxo-1-oxaspiro[5.5]undec-4-ene-7-carboxylate.
| Compound Name | [(3R)-5-oxooxolan-3-yl] (2R,3S,6S,7S,9R)-2-[(2S,5S)-5-(3-hydroxyphenyl)-5-methoxypentan-2-yl]-3,9,11,11-tetramethyl-8-oxo-1-oxaspiro[5.5]undec-4-ene-7-carboxylate |
|---|---|
| PubChem CID | 10973579 |
| Molecular Formula | C31H42O8 |
| Molecular Weight | 542.67 g/mol |
| Exact Mass | 542.29 |
| IUPAC Name | [(3R)-5-oxooxolan-3-yl] (2R,3S,6S,7S,9R)-2-[(2S,5S)-5-(3-hydroxyphenyl)-5-methoxypentan-2-yl]-3,9,11,11-tetramethyl-8-oxo-1-oxaspiro[5.5]undec-4-ene-7-carboxylate |
| SMILES | CO[C@@H](CC[C@H](C)[C@H]1O[C@@]2(C=C[C@@H]1C)[C@H](C(=O)O[C@H]1COC(=O)C1)C(=O)[C@H](C)CC2(C)C)c1cccc(O)c1 |
| InChI | InChI=1S/C31H42O8/c1-18(10-11-24(36-6)21-8-7-9-22(32)14-21)28-19(2)12-13-31(39-28)26(27(34)20(3)16-30(31,4)5)29(35)38-23-15-25(33)37-17-23/h7-9,12-14,18-20,23-24,26,28,32H,10-11,15-17H2,1-6H3/t18-,19-,20+,23+,24-,26-,28+,31-/m0/s1 |
| InChIKey | RYBYHPJXPIRVFK-ZLICLUPHSA-N |
| XLogP | 4.94 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.67 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|