C33H60O4Si — CID 10973646
[(3R,4R)-3-[(2R,4aS,4bS,7S,8aS,10aR)-7-[tert-butyl(dimethyl)silyl]oxy-2,4b-dimethyl-1-oxo-4,4a,5,6,7,8,8a,9,10,10a-decahydro-3H-phenanthren-2-yl]-4-methyloctyl] acetate (PubChem CID 10973646) has the molecular formula C33H60O4Si and a molecular weight of 548.93 g/mol. Its IUPAC name is [(3R,4R)-3-[(2R,4aS,4bS,7S,8aS,10aR)-7-[tert-butyl(dimethyl)silyl]oxy-2,4b-dimethyl-1-oxo-4,4a,5,6,7,8,8a,9,10,10a-decahydro-3H-phenanthren-2-yl]-4-methyloctyl] acetate.
| Compound Name | [(3R,4R)-3-[(2R,4aS,4bS,7S,8aS,10aR)-7-[tert-butyl(dimethyl)silyl]oxy-2,4b-dimethyl-1-oxo-4,4a,5,6,7,8,8a,9,10,10a-decahydro-3H-phenanthren-2-yl]-4-methyloctyl] acetate |
|---|---|
| PubChem CID | 10973646 |
| Molecular Formula | C33H60O4Si |
| Molecular Weight | 548.93 g/mol |
| Exact Mass | 548.43 |
| IUPAC Name | [(3R,4R)-3-[(2R,4aS,4bS,7S,8aS,10aR)-7-[tert-butyl(dimethyl)silyl]oxy-2,4b-dimethyl-1-oxo-4,4a,5,6,7,8,8a,9,10,10a-decahydro-3H-phenanthren-2-yl]-4-methyloctyl] acetate |
| SMILES | CCCC[C@@H](C)[C@@H](CCOC(C)=O)[C@@]1(C)CC[C@H]2[C@@H](CC[C@H]3C[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@@]32C)C1=O |
| InChI | InChI=1S/C33H60O4Si/c1-11-12-13-23(2)28(18-21-36-24(3)34)33(8)20-17-29-27(30(33)35)15-14-25-22-26(16-19-32(25,29)7)37-38(9,10)31(4,5)6/h23,25-29H,11-22H2,1-10H3/t23-,25+,26+,27-,28-,29+,32+,33-/m1/s1 |
| InChIKey | QYGQJOGHGOKSRG-DZUDGXDISA-N |
| XLogP | 8.97 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.93 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|