C33H41N5O3 — CID 10973701
ethyl 2-[6-[3-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]propylamino]imidazo[1,2-b]pyridazin-2-yl]-2-methylpropanoate (PubChem CID 10973701) has the molecular formula C33H41N5O3 and a molecular weight of 555.72 g/mol. Its IUPAC name is ethyl 2-[6-[3-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]propylamino]imidazo[1,2-b]pyridazin-2-yl]-2-methylpropanoate.
| Compound Name | ethyl 2-[6-[3-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]propylamino]imidazo[1,2-b]pyridazin-2-yl]-2-methylpropanoate |
|---|---|
| PubChem CID | 10973701 |
| Molecular Formula | C33H41N5O3 |
| Molecular Weight | 555.72 g/mol |
| Exact Mass | 555.32 |
| IUPAC Name | ethyl 2-[6-[3-[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]propylamino]imidazo[1,2-b]pyridazin-2-yl]-2-methylpropanoate |
| SMILES | CCOC(=O)C(C)(C)c1cn2nc(NCCCN3CCC(C(O)(c4ccccc4)c4ccccc4)CC3)ccc2n1 |
| InChI | InChI=1S/C33H41N5O3/c1-4-41-31(39)32(2,3)28-24-38-30(35-28)17-16-29(36-38)34-20-11-21-37-22-18-27(19-23-37)33(40,25-12-7-5-8-13-25)26-14-9-6-10-15-26/h5-10,12-17,24,27,40H,4,11,18-23H2,1-3H3,(H,34,36) |
| InChIKey | SALURKBZVUCTBC-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 91.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.72 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|