C31H54O7Si — CID 10973802
[(2R,6R,7R,11R,12R,13S,14S,16S)-11,14-dihydroxy-4,4,7,11,17,18,18-heptamethyl-16-triethylsilyloxy-3,5-dioxatetracyclo[12.3.1.02,6.07,12]octadec-1(17)-en-13-yl] acetate (PubChem CID 10973802) has the molecular formula C31H54O7Si and a molecular weight of 566.85 g/mol. Its IUPAC name is [(2R,6R,7R,11R,12R,13S,14S,16S)-11,14-dihydroxy-4,4,7,11,17,18,18-heptamethyl-16-triethylsilyloxy-3,5-dioxatetracyclo[12.3.1.02,6.07,12]octadec-1(17)-en-13-yl] acetate.
| Compound Name | [(2R,6R,7R,11R,12R,13S,14S,16S)-11,14-dihydroxy-4,4,7,11,17,18,18-heptamethyl-16-triethylsilyloxy-3,5-dioxatetracyclo[12.3.1.02,6.07,12]octadec-1(17)-en-13-yl] acetate |
|---|---|
| PubChem CID | 10973802 |
| Molecular Formula | C31H54O7Si |
| Molecular Weight | 566.85 g/mol |
| Exact Mass | 566.36 |
| IUPAC Name | [(2R,6R,7R,11R,12R,13S,14S,16S)-11,14-dihydroxy-4,4,7,11,17,18,18-heptamethyl-16-triethylsilyloxy-3,5-dioxatetracyclo[12.3.1.02,6.07,12]octadec-1(17)-en-13-yl] acetate |
| SMILES | CC[Si](CC)(CC)O[C@H]1C[C@@]2(O)[C@@H](OC(C)=O)[C@H]3[C@@](C)(CCC[C@@]3(C)O)[C@H]3OC(C)(C)O[C@@H]3C(=C1C)C2(C)C |
| InChI | InChI=1S/C31H54O7Si/c1-12-39(13-2,14-3)38-21-18-31(34)26(35-20(5)32)24-29(10,16-15-17-30(24,11)33)25-23(36-28(8,9)37-25)22(19(21)4)27(31,6)7/h21,23-26,33-34H,12-18H2,1-11H3/t21-,23+,24-,25-,26-,29+,30+,31+/m0/s1 |
| InChIKey | AWYQHNKFABVHGK-ADDCNFJHSA-N |
| XLogP | 5.88 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.85 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|