C36H38O6S2 — CID 10974214
[2-[(8S,10S,13S,14S,16R,17S)-16-[bis(benzenesulfinyl)methyl]-10,13-dimethyl-3-oxo-6,7,8,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate (PubChem CID 10974214) has the molecular formula C36H38O6S2 and a molecular weight of 630.83 g/mol. Its IUPAC name is [2-[(8S,10S,13S,14S,16R,17S)-16-[bis(benzenesulfinyl)methyl]-10,13-dimethyl-3-oxo-6,7,8,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate.
| Compound Name | [2-[(8S,10S,13S,14S,16R,17S)-16-[bis(benzenesulfinyl)methyl]-10,13-dimethyl-3-oxo-6,7,8,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 10974214 |
| Molecular Formula | C36H38O6S2 |
| Molecular Weight | 630.83 g/mol |
| Exact Mass | 630.21 |
| IUPAC Name | [2-[(8S,10S,13S,14S,16R,17S)-16-[bis(benzenesulfinyl)methyl]-10,13-dimethyl-3-oxo-6,7,8,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)[C@H]1[C@H](C(S(=O)c2ccccc2)S(=O)c2ccccc2)C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)C3=CC[C@@]21C |
| InChI | InChI=1S/C36H38O6S2/c1-23(37)42-22-32(39)33-29(34(43(40)26-10-6-4-7-11-26)44(41)27-12-8-5-9-13-27)21-31-28-15-14-24-20-25(38)16-18-35(24,2)30(28)17-19-36(31,33)3/h4-13,16-18,20,28-29,31,33-34H,14-15,19,21-22H2,1-3H3/t28-,29-,31+,33-,34?,35+,36+,43?,44?/m1/s1 |
| InChIKey | ZNVQOXAIBRKDJF-YJDFBXEFSA-N |
| XLogP | 6.13 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.83 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|