C32H47IO5Si — CID 10974385
(4S,6R)-6-[(1R)-2-[2-[tert-butyl(dimethyl)silyl]-4-iodofuran-3-yl]-1-hydroxyethyl]-4-[6-[(4-methoxyphenyl)methoxy]hexyl]cyclohex-2-en-1-one (PubChem CID 10974385) has the molecular formula C32H47IO5Si and a molecular weight of 666.71 g/mol. Its IUPAC name is (4S,6R)-6-[(1R)-2-[2-[tert-butyl(dimethyl)silyl]-4-iodofuran-3-yl]-1-hydroxyethyl]-4-[6-[(4-methoxyphenyl)methoxy]hexyl]cyclohex-2-en-1-one.
| Compound Name | (4S,6R)-6-[(1R)-2-[2-[tert-butyl(dimethyl)silyl]-4-iodofuran-3-yl]-1-hydroxyethyl]-4-[6-[(4-methoxyphenyl)methoxy]hexyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 10974385 |
| Molecular Formula | C32H47IO5Si |
| Molecular Weight | 666.71 g/mol |
| Exact Mass | 666.22 |
| IUPAC Name | (4S,6R)-6-[(1R)-2-[2-[tert-butyl(dimethyl)silyl]-4-iodofuran-3-yl]-1-hydroxyethyl]-4-[6-[(4-methoxyphenyl)methoxy]hexyl]cyclohex-2-en-1-one |
| SMILES | COc1ccc(COCCCCCC[C@@H]2C=CC(=O)[C@@H]([C@H](O)Cc3c(I)coc3[Si](C)(C)C(C)(C)C)C2)cc1 |
| InChI | InChI=1S/C32H47IO5Si/c1-32(2,3)39(5,6)31-26(28(33)22-38-31)20-30(35)27-19-23(14-17-29(27)34)11-9-7-8-10-18-37-21-24-12-15-25(36-4)16-13-24/h12-17,22-23,27,30,35H,7-11,18-21H2,1-6H3/t23-,27+,30-/m1/s1 |
| InChIKey | VFHRIZGFPQDPSB-VTTCDHFQSA-N |
| XLogP | 7.44 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.71 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|