C28H30Cl2N3O7P3 — CID 10974441
1,17-dichloro-15,17-dinaphthalen-2-yloxy-2,5,8,11,14-pentaoxa-16,18,19-triaza-1λ5,15λ5,17λ5-triphosphabicyclo[13.3.1]nonadeca-1(19),15,17-triene (PubChem CID 10974441) has the molecular formula C28H30Cl2N3O7P3 and a molecular weight of 684.39 g/mol. Its IUPAC name is 1,17-dichloro-15,17-dinaphthalen-2-yloxy-2,5,8,11,14-pentaoxa-16,18,19-triaza-1λ5,15λ5,17λ5-triphosphabicyclo[13.3.1]nonadeca-1(19),15,17-triene.
| Compound Name | 1,17-dichloro-15,17-dinaphthalen-2-yloxy-2,5,8,11,14-pentaoxa-16,18,19-triaza-1λ5,15λ5,17λ5-triphosphabicyclo[13.3.1]nonadeca-1(19),15,17-triene |
|---|---|
| PubChem CID | 10974441 |
| Molecular Formula | C28H30Cl2N3O7P3 |
| Molecular Weight | 684.39 g/mol |
| Exact Mass | 683.07 |
| IUPAC Name | 1,17-dichloro-15,17-dinaphthalen-2-yloxy-2,5,8,11,14-pentaoxa-16,18,19-triaza-1λ5,15λ5,17λ5-triphosphabicyclo[13.3.1]nonadeca-1(19),15,17-triene |
| SMILES | ClP12=NP(Oc3ccc4ccccc4c3)(=NP(Cl)(Oc3ccc4ccccc4c3)=N1)OCCOCCOCCOCCO2 |
| InChI | InChI=1S/C28H30Cl2N3O7P3/c29-41-31-42(30,39-27-11-9-23-5-1-3-7-25(23)21-27)33-43(32-41,40-28-12-10-24-6-2-4-8-26(24)22-28)38-20-18-36-16-14-34-13-15-35-17-19-37-41/h1-12,21-22H,13-20H2 |
| InChIKey | AAVFAPFKXNMCFD-UHFFFAOYSA-N |
| XLogP | 9.88 |
| TPSA | 101.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.39 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|