C25H44Cl2O14P2 — CID 10974518
[[bis(2,2-dimethylpropanoyloxymethoxy)phosphoryl-dichloromethyl]-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate (PubChem CID 10974518) has the molecular formula C25H44Cl2O14P2 and a molecular weight of 701.47 g/mol. Its IUPAC name is [[bis(2,2-dimethylpropanoyloxymethoxy)phosphoryl-dichloromethyl]-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate.
| Compound Name | [[bis(2,2-dimethylpropanoyloxymethoxy)phosphoryl-dichloromethyl]-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10974518 |
| Molecular Formula | C25H44Cl2O14P2 |
| Molecular Weight | 701.47 g/mol |
| Exact Mass | 700.16 |
| IUPAC Name | [[bis(2,2-dimethylpropanoyloxymethoxy)phosphoryl-dichloromethyl]-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCOP(=O)(OCOC(=O)C(C)(C)C)C(Cl)(Cl)P(=O)(OCOC(=O)C(C)(C)C)OCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C25H44Cl2O14P2/c1-21(2,3)17(28)34-13-38-42(32,39-14-35-18(29)22(4,5)6)25(26,27)43(33,40-15-36-19(30)23(7,8)9)41-16-37-20(31)24(10,11)12/h13-16H2,1-12H3 |
| InChIKey | DQVKNOIZHLUCMZ-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 176.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.47 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|