C50H66Si2 — CID 10974604
2-[5-tert-butyl-2-[8-[4-tert-butyl-2-[2-tri(propan-2-yl)silylethynyl]phenyl]octa-1,3,5,7-tetraynyl]phenyl]ethynyl-tri(propan-2-yl)silane (PubChem CID 10974604) has the molecular formula C50H66Si2 and a molecular weight of 723.25 g/mol. Its IUPAC name is 2-[5-tert-butyl-2-[8-[4-tert-butyl-2-[2-tri(propan-2-yl)silylethynyl]phenyl]octa-1,3,5,7-tetraynyl]phenyl]ethynyl-tri(propan-2-yl)silane.
| Compound Name | 2-[5-tert-butyl-2-[8-[4-tert-butyl-2-[2-tri(propan-2-yl)silylethynyl]phenyl]octa-1,3,5,7-tetraynyl]phenyl]ethynyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 10974604 |
| Molecular Formula | C50H66Si2 |
| Molecular Weight | 723.25 g/mol |
| Exact Mass | 722.47 |
| IUPAC Name | 2-[5-tert-butyl-2-[8-[4-tert-butyl-2-[2-tri(propan-2-yl)silylethynyl]phenyl]octa-1,3,5,7-tetraynyl]phenyl]ethynyl-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](C#Cc1cc(C(C)(C)C)ccc1C#CC#CC#CC#Cc1ccc(C(C)(C)C)cc1C#C[Si](C(C)C)(C(C)C)C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C50H66Si2/c1-37(2)51(38(3)4,39(5)6)33-31-45-35-47(49(13,14)15)29-27-43(45)25-23-21-19-20-22-24-26-44-28-30-48(50(16,17)18)36-46(44)32-34-52(40(7)8,41(9)10)42(11)12/h27-30,35-42H,1-18H3 |
| InChIKey | HRVOAKUJDXKVLV-UHFFFAOYSA-N |
| XLogP | 12.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.25 |
| LogP ≤ 5 | 12.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|