About potassium trimethylsilanide
potassium trimethylsilanide (PubChem CID 10975449) has the molecular formula C3H9KSi
and a molecular weight of 112.29 g/mol. Its IUPAC name is potassium trimethylsilanide.
Molecular Properties
| Compound Name | potassium trimethylsilanide |
| PubChem CID | 10975449 |
| Molecular Formula | C3H9KSi |
| Molecular Weight | 112.29 g/mol |
| Exact Mass | 112.01 |
| IUPAC Name | potassium trimethylsilanide |
| SMILES | C[Si-](C)C.[K+] |
| InChI | InChI=1S/C3H9Si.K/c1-4(2)3;/h1-3H3;/q-1;+1 |
| InChIKey | KBUVKXZWRHGWPP-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.29 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze potassium trimethylsilanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium trimethylsilanide?
The IUPAC name of potassium trimethylsilanide (CID 10975449) is potassium trimethylsilanide.
What is the SMILES notation for potassium trimethylsilanide?
The canonical SMILES for potassium trimethylsilanide is C[Si-](C)C.[K+].
What is the InChIKey of potassium trimethylsilanide?
The InChIKey is KBUVKXZWRHGWPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9Si.K/c1-4(2)3;/h1-3H3;/q-1;+1.
What are the key properties of potassium trimethylsilanide?
potassium trimethylsilanide has a molecular weight of 112.29 g/mol, XLogP of -1.63, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for potassium trimethylsilanide is sourced from PubChem (CID 10975449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).