About [(2S)-1-oxopropan-2-yl] acetate
[(2S)-1-oxopropan-2-yl] acetate (PubChem CID 10975463) has the molecular formula C5H8O3
and a molecular weight of 116.12 g/mol. Its IUPAC name is [(2S)-1-oxopropan-2-yl] acetate.
Molecular Properties
| Compound Name | [(2S)-1-oxopropan-2-yl] acetate |
| PubChem CID | 10975463 |
| Molecular Formula | C5H8O3 |
| Molecular Weight | 116.12 g/mol |
| Exact Mass | 116.05 |
| IUPAC Name | [(2S)-1-oxopropan-2-yl] acetate |
| SMILES | CC(=O)O[C@@H](C)C=O |
| InChI | InChI=1S/C5H8O3/c1-4(3-6)8-5(2)7/h3-4H,1-2H3/t4-/m0/s1 |
| InChIKey | FXPPNKAYSGWCQG-BYPYZUCNSA-N |
| XLogP | 0.14 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.12 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-1-oxopropan-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-1-oxopropan-2-yl] acetate?
The IUPAC name of [(2S)-1-oxopropan-2-yl] acetate (CID 10975463) is [(2S)-1-oxopropan-2-yl] acetate.
What is the SMILES notation for [(2S)-1-oxopropan-2-yl] acetate?
The canonical SMILES for [(2S)-1-oxopropan-2-yl] acetate is CC(=O)O[C@@H](C)C=O.
What is the InChIKey of [(2S)-1-oxopropan-2-yl] acetate?
The InChIKey is FXPPNKAYSGWCQG-BYPYZUCNSA-N. The full InChI is InChI=1S/C5H8O3/c1-4(3-6)8-5(2)7/h3-4H,1-2H3/t4-/m0/s1.
What are the key properties of [(2S)-1-oxopropan-2-yl] acetate?
[(2S)-1-oxopropan-2-yl] acetate has a molecular weight of 116.12 g/mol, XLogP of 0.14, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-1-oxopropan-2-yl] acetate is sourced from PubChem (CID 10975463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).