C7H11NO — CID 10975486
cis-(1R,2S)-2-hydroxycyclohexane-1-carbonitrile (PubChem CID 10975486) has the molecular formula C7H11NO and a molecular weight of 125.17 g/mol. Its IUPAC name is cis-(1R,2S)-2-hydroxycyclohexane-1-carbonitrile.
| Compound Name | cis-(1R,2S)-2-hydroxycyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 10975486 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | cis-(1R,2S)-2-hydroxycyclohexane-1-carbonitrile |
| SMILES | N#C[C@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C7H11NO/c8-5-6-3-1-2-4-7(6)9/h6-7,9H,1-4H2/t6-,7+/m1/s1 |
| InChIKey | MFPCXQNVYPKUSM-RQJHMYQMSA-N |
| XLogP | 1.06 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |