About (3aS,6aR)-6a-methyl-3a,4-dihydro-3H-cyclopenta[b]furan-2-one
(3aS,6aR)-6a-methyl-3a,4-dihydro-3H-cyclopenta[b]furan-2-one (PubChem CID 10975556) has the molecular formula C8H10O2
and a molecular weight of 138.17 g/mol. Its IUPAC name is (3aS,6aR)-6a-methyl-3a,4-dihydro-3H-cyclopenta[b]furan-2-one.
Molecular Properties
| Compound Name | (3aS,6aR)-6a-methyl-3a,4-dihydro-3H-cyclopenta[b]furan-2-one |
| PubChem CID | 10975556 |
| Molecular Formula | C8H10O2 |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.07 |
| IUPAC Name | (3aS,6aR)-6a-methyl-3a,4-dihydro-3H-cyclopenta[b]furan-2-one |
| SMILES | C[C@]12C=CC[C@H]1CC(=O)O2 |
| InChI | InChI=1S/C8H10O2/c1-8-4-2-3-6(8)5-7(9)10-8/h2,4,6H,3,5H2,1H3/t6-,8-/m0/s1 |
| InChIKey | COIZCDLRIGYMCZ-XPUUQOCRSA-N |
| XLogP | 1.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3aS,6aR)-6a-methyl-3a,4-dihydro-3H-cyclopenta[b]furan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3aS,6aR)-6a-methyl-3a,4-dihydro-3H-cyclopenta[b]furan-2-one?
The IUPAC name of (3aS,6aR)-6a-methyl-3a,4-dihydro-3H-cyclopenta[b]furan-2-one (CID 10975556) is (3aS,6aR)-6a-methyl-3a,4-dihydro-3H-cyclopenta[b]furan-2-one.
What is the SMILES notation for (3aS,6aR)-6a-methyl-3a,4-dihydro-3H-cyclopenta[b]furan-2-one?
The canonical SMILES for (3aS,6aR)-6a-methyl-3a,4-dihydro-3H-cyclopenta[b]furan-2-one is C[C@]12C=CC[C@H]1CC(=O)O2.
What is the InChIKey of (3aS,6aR)-6a-methyl-3a,4-dihydro-3H-cyclopenta[b]furan-2-one?
The InChIKey is COIZCDLRIGYMCZ-XPUUQOCRSA-N. The full InChI is InChI=1S/C8H10O2/c1-8-4-2-3-6(8)5-7(9)10-8/h2,4,6H,3,5H2,1H3/t6-,8-/m0/s1.
What are the key properties of (3aS,6aR)-6a-methyl-3a,4-dihydro-3H-cyclopenta[b]furan-2-one?
(3aS,6aR)-6a-methyl-3a,4-dihydro-3H-cyclopenta[b]furan-2-one has a molecular weight of 138.17 g/mol, XLogP of 1.27, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3aS,6aR)-6a-methyl-3a,4-dihydro-3H-cyclopenta[b]furan-2-one is sourced from PubChem (CID 10975556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).