cis-(1S,2R)-2-methoxycarbonylcyclopropane-1-carboxylic acid

C6H8O4 — CID 10975600

IUPACcis-(1S,2R)-2-methoxycarbonylcyclopropane-1-carboxylic acid
SMILESCOC(=O)[C@@H]1C[C@@H]1C(=O)O
InChIInChI=1S/C6H8O4/c1-10-6(9)4-2-3(4)5(7)8/h3-4H,2H2,1H3,(H,7,8)/t3-,4+/m0/s1
InChIKeyIRRAJLZEAOBJIV-IUYQGCFVSA-N
MW144.13 g/mol
LogP-0.12
Rot. Bonds2

About cis-(1S,2R)-2-methoxycarbonylcyclopropane-1-carboxylic acid

cis-(1S,2R)-2-methoxycarbonylcyclopropane-1-carboxylic acid (PubChem CID 10975600) has the molecular formula C6H8O4 and a molecular weight of 144.13 g/mol. Its IUPAC name is cis-(1S,2R)-2-methoxycarbonylcyclopropane-1-carboxylic acid.

Molecular Properties

Compound Namecis-(1S,2R)-2-methoxycarbonylcyclopropane-1-carboxylic acid
PubChem CID10975600
Molecular FormulaC6H8O4
Molecular Weight144.13 g/mol
Exact Mass144.04
IUPAC Namecis-(1S,2R)-2-methoxycarbonylcyclopropane-1-carboxylic acid
SMILESCOC(=O)[C@@H]1C[C@@H]1C(=O)O
InChIInChI=1S/C6H8O4/c1-10-6(9)4-2-3(4)5(7)8/h3-4H,2H2,1H3,(H,7,8)/t3-,4+/m0/s1
InChIKeyIRRAJLZEAOBJIV-IUYQGCFVSA-N
XLogP-0.12
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500144.13
LogP ≤ 5-0.12
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze cis-(1S,2R)-2-methoxycarbonylcyclopropane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of cis-(1S,2R)-2-methoxycarbonylcyclopropane-1-carboxylic acid?
The IUPAC name of cis-(1S,2R)-2-methoxycarbonylcyclopropane-1-carboxylic acid (CID 10975600) is cis-(1S,2R)-2-methoxycarbonylcyclopropane-1-carboxylic acid.
What is the SMILES notation for cis-(1S,2R)-2-methoxycarbonylcyclopropane-1-carboxylic acid?
The canonical SMILES for cis-(1S,2R)-2-methoxycarbonylcyclopropane-1-carboxylic acid is COC(=O)[C@@H]1C[C@@H]1C(=O)O.
What is the InChIKey of cis-(1S,2R)-2-methoxycarbonylcyclopropane-1-carboxylic acid?
The InChIKey is IRRAJLZEAOBJIV-IUYQGCFVSA-N. The full InChI is InChI=1S/C6H8O4/c1-10-6(9)4-2-3(4)5(7)8/h3-4H,2H2,1H3,(H,7,8)/t3-,4+/m0/s1.
What are the key properties of cis-(1S,2R)-2-methoxycarbonylcyclopropane-1-carboxylic acid?
cis-(1S,2R)-2-methoxycarbonylcyclopropane-1-carboxylic acid has a molecular weight of 144.13 g/mol, XLogP of -0.12, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,2R)-2-methoxycarbonylcyclopropane-1-carboxylic acid is sourced from PubChem (CID 10975600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).