About 3-(3-hydroxypropyl)-1,3-oxazolidin-2-one
3-(3-hydroxypropyl)-1,3-oxazolidin-2-one (PubChem CID 10975613) has the molecular formula C6H11NO3
and a molecular weight of 145.16 g/mol. Its IUPAC name is 3-(3-hydroxypropyl)-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 3-(3-hydroxypropyl)-1,3-oxazolidin-2-one |
| PubChem CID | 10975613 |
| Molecular Formula | C6H11NO3 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | 3-(3-hydroxypropyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1OCCN1CCCO |
| InChI | InChI=1S/C6H11NO3/c8-4-1-2-7-3-5-10-6(7)9/h8H,1-5H2 |
| InChIKey | WYNTXFYGOPFHTF-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(3-hydroxypropyl)-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-hydroxypropyl)-1,3-oxazolidin-2-one?
The IUPAC name of 3-(3-hydroxypropyl)-1,3-oxazolidin-2-one (CID 10975613) is 3-(3-hydroxypropyl)-1,3-oxazolidin-2-one.
What is the SMILES notation for 3-(3-hydroxypropyl)-1,3-oxazolidin-2-one?
The canonical SMILES for 3-(3-hydroxypropyl)-1,3-oxazolidin-2-one is O=C1OCCN1CCCO.
What is the InChIKey of 3-(3-hydroxypropyl)-1,3-oxazolidin-2-one?
The InChIKey is WYNTXFYGOPFHTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO3/c8-4-1-2-7-3-5-10-6(7)9/h8H,1-5H2.
What are the key properties of 3-(3-hydroxypropyl)-1,3-oxazolidin-2-one?
3-(3-hydroxypropyl)-1,3-oxazolidin-2-one has a molecular weight of 145.16 g/mol, XLogP of -0.18, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-hydroxypropyl)-1,3-oxazolidin-2-one is sourced from PubChem (CID 10975613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).