C7H15NO2 — CID 10975620
N-methoxy-N,3-dimethylbutanamide (PubChem CID 10975620) has the molecular formula C7H15NO2 and a molecular weight of 145.20 g/mol. Its IUPAC name is N-methoxy-N,3-dimethylbutanamide.
| Compound Name | N-methoxy-N,3-dimethylbutanamide |
|---|---|
| PubChem CID | 10975620 |
| Molecular Formula | C7H15NO2 |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.11 |
| IUPAC Name | N-methoxy-N,3-dimethylbutanamide |
| SMILES | CON(C)C(=O)CC(C)C |
| InChI | InChI=1S/C7H15NO2/c1-6(2)5-7(9)8(3)10-4/h6H,5H2,1-4H3 |
| InChIKey | XRMRJHNLKBFKFF-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|