About (1R)-1-(2,4-dimethylphenyl)ethanol
(1R)-1-(2,4-dimethylphenyl)ethanol (PubChem CID 10975666) has the molecular formula C10H14O
and a molecular weight of 150.22 g/mol. Its IUPAC name is (1R)-1-(2,4-dimethylphenyl)ethanol.
Molecular Properties
| Compound Name | (1R)-1-(2,4-dimethylphenyl)ethanol |
| PubChem CID | 10975666 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | (1R)-1-(2,4-dimethylphenyl)ethanol |
| SMILES | Cc1ccc([C@@H](C)O)c(C)c1 |
| InChI | InChI=1S/C10H14O/c1-7-4-5-10(9(3)11)8(2)6-7/h4-6,9,11H,1-3H3/t9-/m1/s1 |
| InChIKey | DNHQUGRUHBFDFT-SECBINFHSA-N |
| XLogP | 2.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1R)-1-(2,4-dimethylphenyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-(2,4-dimethylphenyl)ethanol?
The IUPAC name of (1R)-1-(2,4-dimethylphenyl)ethanol (CID 10975666) is (1R)-1-(2,4-dimethylphenyl)ethanol.
What is the SMILES notation for (1R)-1-(2,4-dimethylphenyl)ethanol?
The canonical SMILES for (1R)-1-(2,4-dimethylphenyl)ethanol is Cc1ccc([C@@H](C)O)c(C)c1.
What is the InChIKey of (1R)-1-(2,4-dimethylphenyl)ethanol?
The InChIKey is DNHQUGRUHBFDFT-SECBINFHSA-N. The full InChI is InChI=1S/C10H14O/c1-7-4-5-10(9(3)11)8(2)6-7/h4-6,9,11H,1-3H3/t9-/m1/s1.
What are the key properties of (1R)-1-(2,4-dimethylphenyl)ethanol?
(1R)-1-(2,4-dimethylphenyl)ethanol has a molecular weight of 150.22 g/mol, XLogP of 2.36, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-(2,4-dimethylphenyl)ethanol is sourced from PubChem (CID 10975666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).