About ethyl spiro[2.4]hepta-4,6-diene-7-carboxylate
ethyl spiro[2.4]hepta-4,6-diene-7-carboxylate (PubChem CID 10975819) has the molecular formula C10H12O2
and a molecular weight of 164.20 g/mol. Its IUPAC name is ethyl spiro[2.4]hepta-4,6-diene-7-carboxylate.
Molecular Properties
| Compound Name | ethyl spiro[2.4]hepta-4,6-diene-7-carboxylate |
| PubChem CID | 10975819 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | ethyl spiro[2.4]hepta-4,6-diene-7-carboxylate |
| SMILES | CCOC(=O)C1=CC=CC12CC2 |
| InChI | InChI=1S/C10H12O2/c1-2-12-9(11)8-4-3-5-10(8)6-7-10/h3-5H,2,6-7H2,1H3 |
| InChIKey | ZXDULLDIISFZPS-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethyl spiro[2.4]hepta-4,6-diene-7-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl spiro[2.4]hepta-4,6-diene-7-carboxylate?
The IUPAC name of ethyl spiro[2.4]hepta-4,6-diene-7-carboxylate (CID 10975819) is ethyl spiro[2.4]hepta-4,6-diene-7-carboxylate.
What is the SMILES notation for ethyl spiro[2.4]hepta-4,6-diene-7-carboxylate?
The canonical SMILES for ethyl spiro[2.4]hepta-4,6-diene-7-carboxylate is CCOC(=O)C1=CC=CC12CC2.
What is the InChIKey of ethyl spiro[2.4]hepta-4,6-diene-7-carboxylate?
The InChIKey is ZXDULLDIISFZPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2/c1-2-12-9(11)8-4-3-5-10(8)6-7-10/h3-5H,2,6-7H2,1H3.
What are the key properties of ethyl spiro[2.4]hepta-4,6-diene-7-carboxylate?
ethyl spiro[2.4]hepta-4,6-diene-7-carboxylate has a molecular weight of 164.20 g/mol, XLogP of 1.83, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl spiro[2.4]hepta-4,6-diene-7-carboxylate is sourced from PubChem (CID 10975819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).