morpholine-4-sulfinyl chloride

C4H8ClNO2S — CID 10975900

IUPACmorpholine-4-sulfinyl chloride
SMILESO=S(Cl)N1CCOCC1
InChIInChI=1S/C4H8ClNO2S/c5-9(7)6-1-3-8-4-2-6/h1-4H2
InChIKeySMJNPNFAAQWJER-UHFFFAOYSA-N
MW169.63 g/mol
LogP0.14
Rot. Bonds1

About morpholine-4-sulfinyl chloride

morpholine-4-sulfinyl chloride (PubChem CID 10975900) has the molecular formula C4H8ClNO2S and a molecular weight of 169.63 g/mol. Its IUPAC name is morpholine-4-sulfinyl chloride.

Molecular Properties

Compound Namemorpholine-4-sulfinyl chloride
PubChem CID10975900
Molecular FormulaC4H8ClNO2S
Molecular Weight169.63 g/mol
Exact Mass169.00
IUPAC Namemorpholine-4-sulfinyl chloride
SMILESO=S(Cl)N1CCOCC1
InChIInChI=1S/C4H8ClNO2S/c5-9(7)6-1-3-8-4-2-6/h1-4H2
InChIKeySMJNPNFAAQWJER-UHFFFAOYSA-N
XLogP0.14
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500169.63
LogP ≤ 50.14
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze morpholine-4-sulfinyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of morpholine-4-sulfinyl chloride?
The IUPAC name of morpholine-4-sulfinyl chloride (CID 10975900) is morpholine-4-sulfinyl chloride.
What is the SMILES notation for morpholine-4-sulfinyl chloride?
The canonical SMILES for morpholine-4-sulfinyl chloride is O=S(Cl)N1CCOCC1.
What is the InChIKey of morpholine-4-sulfinyl chloride?
The InChIKey is SMJNPNFAAQWJER-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8ClNO2S/c5-9(7)6-1-3-8-4-2-6/h1-4H2.
What are the key properties of morpholine-4-sulfinyl chloride?
morpholine-4-sulfinyl chloride has a molecular weight of 169.63 g/mol, XLogP of 0.14, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for morpholine-4-sulfinyl chloride is sourced from PubChem (CID 10975900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).