About morpholine-4-sulfinyl chloride
morpholine-4-sulfinyl chloride (PubChem CID 10975900) has the molecular formula C4H8ClNO2S
and a molecular weight of 169.63 g/mol. Its IUPAC name is morpholine-4-sulfinyl chloride.
Molecular Properties
| Compound Name | morpholine-4-sulfinyl chloride |
| PubChem CID | 10975900 |
| Molecular Formula | C4H8ClNO2S |
| Molecular Weight | 169.63 g/mol |
| Exact Mass | 169.00 |
| IUPAC Name | morpholine-4-sulfinyl chloride |
| SMILES | O=S(Cl)N1CCOCC1 |
| InChI | InChI=1S/C4H8ClNO2S/c5-9(7)6-1-3-8-4-2-6/h1-4H2 |
| InChIKey | SMJNPNFAAQWJER-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.63 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze morpholine-4-sulfinyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of morpholine-4-sulfinyl chloride?
The IUPAC name of morpholine-4-sulfinyl chloride (CID 10975900) is morpholine-4-sulfinyl chloride.
What is the SMILES notation for morpholine-4-sulfinyl chloride?
The canonical SMILES for morpholine-4-sulfinyl chloride is O=S(Cl)N1CCOCC1.
What is the InChIKey of morpholine-4-sulfinyl chloride?
The InChIKey is SMJNPNFAAQWJER-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8ClNO2S/c5-9(7)6-1-3-8-4-2-6/h1-4H2.
What are the key properties of morpholine-4-sulfinyl chloride?
morpholine-4-sulfinyl chloride has a molecular weight of 169.63 g/mol, XLogP of 0.14, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for morpholine-4-sulfinyl chloride is sourced from PubChem (CID 10975900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).