About [2-[(2S)-4-aminobutan-2-yl]-1,3-oxazol-4-yl]methanol
[2-[(2S)-4-aminobutan-2-yl]-1,3-oxazol-4-yl]methanol (PubChem CID 10975920) has the molecular formula C8H14N2O2
and a molecular weight of 170.21 g/mol. Its IUPAC name is [2-[(2S)-4-aminobutan-2-yl]-1,3-oxazol-4-yl]methanol.
Molecular Properties
| Compound Name | [2-[(2S)-4-aminobutan-2-yl]-1,3-oxazol-4-yl]methanol |
| PubChem CID | 10975920 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | [2-[(2S)-4-aminobutan-2-yl]-1,3-oxazol-4-yl]methanol |
| SMILES | C[C@@H](CCN)c1nc(CO)co1 |
| InChI | InChI=1S/C8H14N2O2/c1-6(2-3-9)8-10-7(4-11)5-12-8/h5-6,11H,2-4,9H2,1H3/t6-/m0/s1 |
| InChIKey | XQJYWIXGZBYVDR-LURJTMIESA-N |
| XLogP | 0.62 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-[(2S)-4-aminobutan-2-yl]-1,3-oxazol-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(2S)-4-aminobutan-2-yl]-1,3-oxazol-4-yl]methanol?
The IUPAC name of [2-[(2S)-4-aminobutan-2-yl]-1,3-oxazol-4-yl]methanol (CID 10975920) is [2-[(2S)-4-aminobutan-2-yl]-1,3-oxazol-4-yl]methanol.
What is the SMILES notation for [2-[(2S)-4-aminobutan-2-yl]-1,3-oxazol-4-yl]methanol?
The canonical SMILES for [2-[(2S)-4-aminobutan-2-yl]-1,3-oxazol-4-yl]methanol is C[C@@H](CCN)c1nc(CO)co1.
What is the InChIKey of [2-[(2S)-4-aminobutan-2-yl]-1,3-oxazol-4-yl]methanol?
The InChIKey is XQJYWIXGZBYVDR-LURJTMIESA-N. The full InChI is InChI=1S/C8H14N2O2/c1-6(2-3-9)8-10-7(4-11)5-12-8/h5-6,11H,2-4,9H2,1H3/t6-/m0/s1.
What are the key properties of [2-[(2S)-4-aminobutan-2-yl]-1,3-oxazol-4-yl]methanol?
[2-[(2S)-4-aminobutan-2-yl]-1,3-oxazol-4-yl]methanol has a molecular weight of 170.21 g/mol, XLogP of 0.62, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(2S)-4-aminobutan-2-yl]-1,3-oxazol-4-yl]methanol is sourced from PubChem (CID 10975920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).