C10H18O2 — CID 10975925
[(3R)-4,4-dimethylhex-5-en-3-yl] acetate (PubChem CID 10975925) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is [(3R)-4,4-dimethylhex-5-en-3-yl] acetate.
| Compound Name | [(3R)-4,4-dimethylhex-5-en-3-yl] acetate |
|---|---|
| PubChem CID | 10975925 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | [(3R)-4,4-dimethylhex-5-en-3-yl] acetate |
| SMILES | C=CC(C)(C)[C@@H](CC)OC(C)=O |
| InChI | InChI=1S/C10H18O2/c1-6-9(12-8(3)11)10(4,5)7-2/h7,9H,2,6H2,1,3-5H3/t9-/m1/s1 |
| InChIKey | PGNDMZYHWCBZBL-SECBINFHSA-N |
| XLogP | 2.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|