About 1,1,3,3-tetramethylselenourea
1,1,3,3-tetramethylselenourea (PubChem CID 10976069) has the molecular formula C5H12N2Se
and a molecular weight of 179.12 g/mol. Its IUPAC name is 1,1,3,3-tetramethylselenourea.
Molecular Properties
| Compound Name | 1,1,3,3-tetramethylselenourea |
| PubChem CID | 10976069 |
| Molecular Formula | C5H12N2Se |
| Molecular Weight | 179.12 g/mol |
| Exact Mass | 180.02 |
| IUPAC Name | 1,1,3,3-tetramethylselenourea |
| SMILES | CN(C)C(=[Se])N(C)C |
| InChI | InChI=1S/C5H12N2Se/c1-6(2)5(8)7(3)4/h1-4H3 |
| InChIKey | WUKNXMYCJYGLGA-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.12 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1,1,3,3-tetramethylselenourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,3,3-tetramethylselenourea?
The IUPAC name of 1,1,3,3-tetramethylselenourea (CID 10976069) is 1,1,3,3-tetramethylselenourea.
What is the SMILES notation for 1,1,3,3-tetramethylselenourea?
The canonical SMILES for 1,1,3,3-tetramethylselenourea is CN(C)C(=[Se])N(C)C.
What is the InChIKey of 1,1,3,3-tetramethylselenourea?
The InChIKey is WUKNXMYCJYGLGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2Se/c1-6(2)5(8)7(3)4/h1-4H3.
What are the key properties of 1,1,3,3-tetramethylselenourea?
1,1,3,3-tetramethylselenourea has a molecular weight of 179.12 g/mol, XLogP of -0.63, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,3,3-tetramethylselenourea is sourced from PubChem (CID 10976069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).