About 5-(2-methylpropyl)-4,7-dihydro-1,3-benzodioxole
5-(2-methylpropyl)-4,7-dihydro-1,3-benzodioxole (PubChem CID 10976092) has the molecular formula C11H16O2
and a molecular weight of 180.25 g/mol. Its IUPAC name is 5-(2-methylpropyl)-4,7-dihydro-1,3-benzodioxole.
Molecular Properties
| Compound Name | 5-(2-methylpropyl)-4,7-dihydro-1,3-benzodioxole |
| PubChem CID | 10976092 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 5-(2-methylpropyl)-4,7-dihydro-1,3-benzodioxole |
| SMILES | CC(C)CC1=CCC2=C(C1)OCO2 |
| InChI | InChI=1S/C11H16O2/c1-8(2)5-9-3-4-10-11(6-9)13-7-12-10/h3,8H,4-7H2,1-2H3 |
| InChIKey | JSXRGEAABKLDJE-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-methylpropyl)-4,7-dihydro-1,3-benzodioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-methylpropyl)-4,7-dihydro-1,3-benzodioxole?
The IUPAC name of 5-(2-methylpropyl)-4,7-dihydro-1,3-benzodioxole (CID 10976092) is 5-(2-methylpropyl)-4,7-dihydro-1,3-benzodioxole.
What is the SMILES notation for 5-(2-methylpropyl)-4,7-dihydro-1,3-benzodioxole?
The canonical SMILES for 5-(2-methylpropyl)-4,7-dihydro-1,3-benzodioxole is CC(C)CC1=CCC2=C(C1)OCO2.
What is the InChIKey of 5-(2-methylpropyl)-4,7-dihydro-1,3-benzodioxole?
The InChIKey is JSXRGEAABKLDJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O2/c1-8(2)5-9-3-4-10-11(6-9)13-7-12-10/h3,8H,4-7H2,1-2H3.
What are the key properties of 5-(2-methylpropyl)-4,7-dihydro-1,3-benzodioxole?
5-(2-methylpropyl)-4,7-dihydro-1,3-benzodioxole has a molecular weight of 180.25 g/mol, XLogP of 2.97, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-methylpropyl)-4,7-dihydro-1,3-benzodioxole is sourced from PubChem (CID 10976092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).