C10H17NO2 — CID 10976141
(5E,7S)-7-(hydroxymethyl)-1-methyl-3,4,7,8-tetrahydro-2H-azonin-9-one (PubChem CID 10976141) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is (5E,7S)-7-(hydroxymethyl)-1-methyl-3,4,7,8-tetrahydro-2H-azonin-9-one.
| Compound Name | (5E,7S)-7-(hydroxymethyl)-1-methyl-3,4,7,8-tetrahydro-2H-azonin-9-one |
|---|---|
| PubChem CID | 10976141 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | (5E,7S)-7-(hydroxymethyl)-1-methyl-3,4,7,8-tetrahydro-2H-azonin-9-one |
| SMILES | CN1CCC/C=C/[C@@H](CO)CC1=O |
| InChI | InChI=1S/C10H17NO2/c1-11-6-4-2-3-5-9(8-12)7-10(11)13/h3,5,9,12H,2,4,6-8H2,1H3/b5-3+/t9-/m1/s1 |
| InChIKey | YQMGOIBTVHZHCM-HYYFJVDXSA-N |
| XLogP | 0.79 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|