About azulene-1,3-dicarbaldehyde
azulene-1,3-dicarbaldehyde (PubChem CID 10976152) has the molecular formula C12H8O2
and a molecular weight of 184.19 g/mol. Its IUPAC name is azulene-1,3-dicarbaldehyde.
Molecular Properties
| Compound Name | azulene-1,3-dicarbaldehyde |
| PubChem CID | 10976152 |
| Molecular Formula | C12H8O2 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | azulene-1,3-dicarbaldehyde |
| SMILES | O=Cc1cc(C=O)c2cccccc1-2 |
| InChI | InChI=1S/C12H8O2/c13-7-9-6-10(8-14)12-5-3-1-2-4-11(9)12/h1-8H |
| InChIKey | XFOPUARCKUPXFN-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze azulene-1,3-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azulene-1,3-dicarbaldehyde?
The IUPAC name of azulene-1,3-dicarbaldehyde (CID 10976152) is azulene-1,3-dicarbaldehyde.
What is the SMILES notation for azulene-1,3-dicarbaldehyde?
The canonical SMILES for azulene-1,3-dicarbaldehyde is O=Cc1cc(C=O)c2cccccc1-2.
What is the InChIKey of azulene-1,3-dicarbaldehyde?
The InChIKey is XFOPUARCKUPXFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8O2/c13-7-9-6-10(8-14)12-5-3-1-2-4-11(9)12/h1-8H.
What are the key properties of azulene-1,3-dicarbaldehyde?
azulene-1,3-dicarbaldehyde has a molecular weight of 184.19 g/mol, XLogP of 2.42, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azulene-1,3-dicarbaldehyde is sourced from PubChem (CID 10976152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).