C11H22O2 — CID 10976210
5-hydroxy-2,2,6,6-tetramethylheptan-3-one (PubChem CID 10976210) has the molecular formula C11H22O2 and a molecular weight of 186.29 g/mol. Its IUPAC name is 5-hydroxy-2,2,6,6-tetramethylheptan-3-one.
| Compound Name | 5-hydroxy-2,2,6,6-tetramethylheptan-3-one |
|---|---|
| PubChem CID | 10976210 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | 5-hydroxy-2,2,6,6-tetramethylheptan-3-one |
| SMILES | CC(C)(C)C(=O)CC(O)C(C)(C)C |
| InChI | InChI=1S/C11H22O2/c1-10(2,3)8(12)7-9(13)11(4,5)6/h8,12H,7H2,1-6H3 |
| InChIKey | RCCXZJRKQOWRTP-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |