C9H8F3NO — CID 10976557
(E)-1,1,1-trifluoro-4-(1-methylpyrrol-2-yl)but-3-en-2-one (PubChem CID 10976557) has the molecular formula C9H8F3NO and a molecular weight of 203.16 g/mol. Its IUPAC name is (E)-1,1,1-trifluoro-4-(1-methylpyrrol-2-yl)but-3-en-2-one.
| Compound Name | (E)-1,1,1-trifluoro-4-(1-methylpyrrol-2-yl)but-3-en-2-one |
|---|---|
| PubChem CID | 10976557 |
| Molecular Formula | C9H8F3NO |
| Molecular Weight | 203.16 g/mol |
| Exact Mass | 203.06 |
| IUPAC Name | (E)-1,1,1-trifluoro-4-(1-methylpyrrol-2-yl)but-3-en-2-one |
| SMILES | Cn1cccc1/C=C/C(=O)C(F)(F)F |
| InChI | InChI=1S/C9H8F3NO/c1-13-6-2-3-7(13)4-5-8(14)9(10,11)12/h2-6H,1H3/b5-4+ |
| InChIKey | QISSFQHXTXJMRH-SNAWJCMRSA-N |
| XLogP | 2.17 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.16 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|