About N-tert-butyl-1-(2,4,6-trimethylphenyl)methanimine
N-tert-butyl-1-(2,4,6-trimethylphenyl)methanimine (PubChem CID 10976566) has the molecular formula C14H21N
and a molecular weight of 203.33 g/mol. Its IUPAC name is N-tert-butyl-1-(2,4,6-trimethylphenyl)methanimine.
Molecular Properties
| Compound Name | N-tert-butyl-1-(2,4,6-trimethylphenyl)methanimine |
| PubChem CID | 10976566 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | N-tert-butyl-1-(2,4,6-trimethylphenyl)methanimine |
| SMILES | Cc1cc(C)c(/C=N/C(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C14H21N/c1-10-7-11(2)13(12(3)8-10)9-15-14(4,5)6/h7-9H,1-6H3/b15-9+ |
| InChIKey | NFGUUYMHNVAVJP-OQLLNIDSSA-N |
| XLogP | 3.83 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-1-(2,4,6-trimethylphenyl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-1-(2,4,6-trimethylphenyl)methanimine?
The IUPAC name of N-tert-butyl-1-(2,4,6-trimethylphenyl)methanimine (CID 10976566) is N-tert-butyl-1-(2,4,6-trimethylphenyl)methanimine.
What is the SMILES notation for N-tert-butyl-1-(2,4,6-trimethylphenyl)methanimine?
The canonical SMILES for N-tert-butyl-1-(2,4,6-trimethylphenyl)methanimine is Cc1cc(C)c(/C=N/C(C)(C)C)c(C)c1.
What is the InChIKey of N-tert-butyl-1-(2,4,6-trimethylphenyl)methanimine?
The InChIKey is NFGUUYMHNVAVJP-OQLLNIDSSA-N. The full InChI is InChI=1S/C14H21N/c1-10-7-11(2)13(12(3)8-10)9-15-14(4,5)6/h7-9H,1-6H3/b15-9+.
What are the key properties of N-tert-butyl-1-(2,4,6-trimethylphenyl)methanimine?
N-tert-butyl-1-(2,4,6-trimethylphenyl)methanimine has a molecular weight of 203.33 g/mol, XLogP of 3.83, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-1-(2,4,6-trimethylphenyl)methanimine is sourced from PubChem (CID 10976566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).