C12H16O3 — CID 10976686
(1S,3R,6R,7S)-3-methoxy-6,8-dimethyl-4-oxatricyclo[4.3.1.03,7]dec-8-en-2-one (PubChem CID 10976686) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is (1S,3R,6R,7S)-3-methoxy-6,8-dimethyl-4-oxatricyclo[4.3.1.03,7]dec-8-en-2-one.
| Compound Name | (1S,3R,6R,7S)-3-methoxy-6,8-dimethyl-4-oxatricyclo[4.3.1.03,7]dec-8-en-2-one |
|---|---|
| PubChem CID | 10976686 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | (1S,3R,6R,7S)-3-methoxy-6,8-dimethyl-4-oxatricyclo[4.3.1.03,7]dec-8-en-2-one |
| SMILES | CO[C@@]12OC[C@]3(C)C[C@@H](C=C(C)[C@@H]31)C2=O |
| InChI | InChI=1S/C12H16O3/c1-7-4-8-5-11(2)6-15-12(14-3,9(7)11)10(8)13/h4,8-9H,5-6H2,1-3H3/t8-,9+,11+,12-/m1/s1 |
| InChIKey | SDOKHULKCKYVAR-LLHIFLOGSA-N |
| XLogP | 1.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|