About [(2R)-1-chloro-3,3-dimethylbutan-2-yl] 2-chloroacetate
[(2R)-1-chloro-3,3-dimethylbutan-2-yl] 2-chloroacetate (PubChem CID 10976792) has the molecular formula C8H14Cl2O2
and a molecular weight of 213.10 g/mol. Its IUPAC name is [(2R)-1-chloro-3,3-dimethylbutan-2-yl] 2-chloroacetate.
Molecular Properties
| Compound Name | [(2R)-1-chloro-3,3-dimethylbutan-2-yl] 2-chloroacetate |
| PubChem CID | 10976792 |
| Molecular Formula | C8H14Cl2O2 |
| Molecular Weight | 213.10 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | [(2R)-1-chloro-3,3-dimethylbutan-2-yl] 2-chloroacetate |
| SMILES | CC(C)(C)[C@H](CCl)OC(=O)CCl |
| InChI | InChI=1S/C8H14Cl2O2/c1-8(2,3)6(4-9)12-7(11)5-10/h6H,4-5H2,1-3H3/t6-/m0/s1 |
| InChIKey | JYIAWDDUWJVDKS-LURJTMIESA-N |
| XLogP | 2.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.10 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-1-chloro-3,3-dimethylbutan-2-yl] 2-chloroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-1-chloro-3,3-dimethylbutan-2-yl] 2-chloroacetate?
The IUPAC name of [(2R)-1-chloro-3,3-dimethylbutan-2-yl] 2-chloroacetate (CID 10976792) is [(2R)-1-chloro-3,3-dimethylbutan-2-yl] 2-chloroacetate.
What is the SMILES notation for [(2R)-1-chloro-3,3-dimethylbutan-2-yl] 2-chloroacetate?
The canonical SMILES for [(2R)-1-chloro-3,3-dimethylbutan-2-yl] 2-chloroacetate is CC(C)(C)[C@H](CCl)OC(=O)CCl.
What is the InChIKey of [(2R)-1-chloro-3,3-dimethylbutan-2-yl] 2-chloroacetate?
The InChIKey is JYIAWDDUWJVDKS-LURJTMIESA-N. The full InChI is InChI=1S/C8H14Cl2O2/c1-8(2,3)6(4-9)12-7(11)5-10/h6H,4-5H2,1-3H3/t6-/m0/s1.
What are the key properties of [(2R)-1-chloro-3,3-dimethylbutan-2-yl] 2-chloroacetate?
[(2R)-1-chloro-3,3-dimethylbutan-2-yl] 2-chloroacetate has a molecular weight of 213.10 g/mol, XLogP of 2.42, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-1-chloro-3,3-dimethylbutan-2-yl] 2-chloroacetate is sourced from PubChem (CID 10976792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).