About methyl 2-acetyl-3-oxooctanoate
methyl 2-acetyl-3-oxooctanoate (PubChem CID 10976817) has the molecular formula C11H18O4
and a molecular weight of 214.26 g/mol. Its IUPAC name is methyl 2-acetyl-3-oxooctanoate.
Molecular Properties
| Compound Name | methyl 2-acetyl-3-oxooctanoate |
| PubChem CID | 10976817 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | methyl 2-acetyl-3-oxooctanoate |
| SMILES | CCCCCC(=O)C(C(C)=O)C(=O)OC |
| InChI | InChI=1S/C11H18O4/c1-4-5-6-7-9(13)10(8(2)12)11(14)15-3/h10H,4-7H2,1-3H3 |
| InChIKey | NNCFKVNXRVEJLL-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-acetyl-3-oxooctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-acetyl-3-oxooctanoate?
The IUPAC name of methyl 2-acetyl-3-oxooctanoate (CID 10976817) is methyl 2-acetyl-3-oxooctanoate.
What is the SMILES notation for methyl 2-acetyl-3-oxooctanoate?
The canonical SMILES for methyl 2-acetyl-3-oxooctanoate is CCCCCC(=O)C(C(C)=O)C(=O)OC.
What is the InChIKey of methyl 2-acetyl-3-oxooctanoate?
The InChIKey is NNCFKVNXRVEJLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O4/c1-4-5-6-7-9(13)10(8(2)12)11(14)15-3/h10H,4-7H2,1-3H3.
What are the key properties of methyl 2-acetyl-3-oxooctanoate?
methyl 2-acetyl-3-oxooctanoate has a molecular weight of 214.26 g/mol, XLogP of 1.51, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-acetyl-3-oxooctanoate is sourced from PubChem (CID 10976817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).